About tert-butyl 4-[4-(4-fluorobenzoyl)-1,4-diazepane-1-carbonyl]oxane-4-carboxylate
tert-butyl 4-[4-(4-fluorobenzoyl)-1,4-diazepane-1-carbonyl]oxane-4-carboxylate (PubChem CID 167911032) has the molecular formula C23H31FN2O5
and a molecular weight of 434.51 g/mol. Its IUPAC name is tert-butyl 4-[4-(4-fluorobenzoyl)-1,4-diazepane-1-carbonyl]oxane-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[4-(4-fluorobenzoyl)-1,4-diazepane-1-carbonyl]oxane-4-carboxylate |
| PubChem CID | 167911032 |
| Molecular Formula | C23H31FN2O5 |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | tert-butyl 4-[4-(4-fluorobenzoyl)-1,4-diazepane-1-carbonyl]oxane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C(=O)N2CCCN(C(=O)c3ccc(F)cc3)CC2)CCOCC1 |
| InChI | InChI=1S/C23H31FN2O5/c1-22(2,3)31-21(29)23(9-15-30-16-10-23)20(28)26-12-4-11-25(13-14-26)19(27)17-5-7-18(24)8-6-17/h5-8H,4,9-16H2,1-3H3 |
| InChIKey | AIEMHAQQYVDPJF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[4-(4-fluorobenzoyl)-1,4-diazepane-1-carbonyl]oxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[4-(4-fluorobenzoyl)-1,4-diazepane-1-carbonyl]oxane-4-carboxylate?
The IUPAC name of tert-butyl 4-[4-(4-fluorobenzoyl)-1,4-diazepane-1-carbonyl]oxane-4-carboxylate (CID 167911032) is tert-butyl 4-[4-(4-fluorobenzoyl)-1,4-diazepane-1-carbonyl]oxane-4-carboxylate.
What is the SMILES notation for tert-butyl 4-[4-(4-fluorobenzoyl)-1,4-diazepane-1-carbonyl]oxane-4-carboxylate?
The canonical SMILES for tert-butyl 4-[4-(4-fluorobenzoyl)-1,4-diazepane-1-carbonyl]oxane-4-carboxylate is CC(C)(C)OC(=O)C1(C(=O)N2CCCN(C(=O)c3ccc(F)cc3)CC2)CCOCC1.
What is the InChIKey of tert-butyl 4-[4-(4-fluorobenzoyl)-1,4-diazepane-1-carbonyl]oxane-4-carboxylate?
The InChIKey is AIEMHAQQYVDPJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31FN2O5/c1-22(2,3)31-21(29)23(9-15-30-16-10-23)20(28)26-12-4-11-25(13-14-26)19(27)17-5-7-18(24)8-6-17/h5-8H,4,9-16H2,1-3H3.
What are the key properties of tert-butyl 4-[4-(4-fluorobenzoyl)-1,4-diazepane-1-carbonyl]oxane-4-carboxylate?
tert-butyl 4-[4-(4-fluorobenzoyl)-1,4-diazepane-1-carbonyl]oxane-4-carboxylate has a molecular weight of 434.51 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[4-(4-fluorobenzoyl)-1,4-diazepane-1-carbonyl]oxane-4-carboxylate is sourced from PubChem (CID 167911032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).