C19H28N2O2 — CID 167913357
N-[2-(4-tert-butylphenyl)propan-2-yl]-2-oxopiperidine-4-carboxamide (PubChem CID 167913357) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)propan-2-yl]-2-oxopiperidine-4-carboxamide.
| Compound Name | N-[2-(4-tert-butylphenyl)propan-2-yl]-2-oxopiperidine-4-carboxamide |
|---|---|
| PubChem CID | 167913357 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)propan-2-yl]-2-oxopiperidine-4-carboxamide |
| SMILES | CC(C)(C)c1ccc(C(C)(C)NC(=O)C2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C19H28N2O2/c1-18(2,3)14-6-8-15(9-7-14)19(4,5)21-17(23)13-10-11-20-16(22)12-13/h6-9,13H,10-12H2,1-5H3,(H,20,22)(H,21,23) |
| InChIKey | WRJMICCVSFKZSU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |