C17H14N2O2 — CID 167914139
2-(2,3-dihydro-1-benzofuran-5-yl)-4-methylphthalazin-1-one (PubChem CID 167914139) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-yl)-4-methylphthalazin-1-one.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-4-methylphthalazin-1-one |
|---|---|
| PubChem CID | 167914139 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-yl)-4-methylphthalazin-1-one |
| SMILES | Cc1nn(-c2ccc3c(c2)CCO3)c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H14N2O2/c1-11-14-4-2-3-5-15(14)17(20)19(18-11)13-6-7-16-12(10-13)8-9-21-16/h2-7,10H,8-9H2,1H3 |
| InChIKey | VSVBMIYKVAZBMW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |