C18H16N2O2S — CID 94870192
3-[(1S)-1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 94870192) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is 3-[(1S)-1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-[(1S)-1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 94870192 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 3-[(1S)-1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | C[C@@H](c1ccc2c(c1)CCO2)n1c(=S)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C18H16N2O2S/c1-11(12-6-7-16-13(10-12)8-9-22-16)20-17(21)14-4-2-3-5-15(14)19-18(20)23/h2-7,10-11H,8-9H2,1H3,(H,19,23)/t11-/m0/s1 |
| InChIKey | LDEIYBBJHQCZHX-NSHDSACASA-N |
| XLogP | 3.60 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|