C18H17N5O3 — CID 167915885
5-[2-[(6-pyridin-4-ylpyridine-2-carbonyl)amino]propan-2-yl]-1H-pyrazole-3-carboxylic acid (PubChem CID 167915885) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is 5-[2-[(6-pyridin-4-ylpyridine-2-carbonyl)amino]propan-2-yl]-1H-pyrazole-3-carboxylic acid.
| Compound Name | 5-[2-[(6-pyridin-4-ylpyridine-2-carbonyl)amino]propan-2-yl]-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 167915885 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 5-[2-[(6-pyridin-4-ylpyridine-2-carbonyl)amino]propan-2-yl]-1H-pyrazole-3-carboxylic acid |
| SMILES | CC(C)(NC(=O)c1cccc(-c2ccncc2)n1)c1cc(C(=O)O)n[nH]1 |
| InChI | InChI=1S/C18H17N5O3/c1-18(2,15-10-14(17(25)26)22-23-15)21-16(24)13-5-3-4-12(20-13)11-6-8-19-9-7-11/h3-10H,1-2H3,(H,21,24)(H,22,23)(H,25,26) |
| InChIKey | IXXVYRLUKRLJMP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |