C6H4F4N2O2 — CID 87941387
5-(1,1,2,2-tetrafluoroethyl)-1H-pyrazole-3-carboxylic acid (PubChem CID 87941387) has the molecular formula C6H4F4N2O2 and a molecular weight of 212.10 g/mol. Its IUPAC name is 5-(1,1,2,2-tetrafluoroethyl)-1H-pyrazole-3-carboxylic acid.
| Compound Name | 5-(1,1,2,2-tetrafluoroethyl)-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 87941387 |
| Molecular Formula | C6H4F4N2O2 |
| Molecular Weight | 212.10 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 5-(1,1,2,2-tetrafluoroethyl)-1H-pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(C(F)(F)C(F)F)[nH]n1 |
| InChI | InChI=1S/C6H4F4N2O2/c7-5(8)6(9,10)3-1-2(4(13)14)11-12-3/h1,5H,(H,11,12)(H,13,14) |
| InChIKey | CBDMSNCHAURQTE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.10 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|