C19H12N6O — CID 167918167
3-isoquinolin-1-yl-5-(1-phenyltriazol-4-yl)-1,2,4-oxadiazole (PubChem CID 167918167) has the molecular formula C19H12N6O and a molecular weight of 340.35 g/mol. Its IUPAC name is 3-isoquinolin-1-yl-5-(1-phenyltriazol-4-yl)-1,2,4-oxadiazole.
| Compound Name | 3-isoquinolin-1-yl-5-(1-phenyltriazol-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 167918167 |
| Molecular Formula | C19H12N6O |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 3-isoquinolin-1-yl-5-(1-phenyltriazol-4-yl)-1,2,4-oxadiazole |
| SMILES | c1ccc(-n2cc(-c3nc(-c4nccc5ccccc45)no3)nn2)cc1 |
| InChI | InChI=1S/C19H12N6O/c1-2-7-14(8-3-1)25-12-16(22-24-25)19-21-18(23-26-19)17-15-9-5-4-6-13(15)10-11-20-17/h1-12H |
| InChIKey | TUGYUUFDFIVPMI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |