C21H27ClN4O2 — CID 167919141
2-chloro-N-[3-[3-methyl-1-(1-phenylpyrazole-3-carbonyl)piperidin-2-yl]propyl]acetamide (PubChem CID 167919141) has the molecular formula C21H27ClN4O2 and a molecular weight of 402.93 g/mol. Its IUPAC name is 2-chloro-N-[3-[3-methyl-1-(1-phenylpyrazole-3-carbonyl)piperidin-2-yl]propyl]acetamide.
| Compound Name | 2-chloro-N-[3-[3-methyl-1-(1-phenylpyrazole-3-carbonyl)piperidin-2-yl]propyl]acetamide |
|---|---|
| PubChem CID | 167919141 |
| Molecular Formula | C21H27ClN4O2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-chloro-N-[3-[3-methyl-1-(1-phenylpyrazole-3-carbonyl)piperidin-2-yl]propyl]acetamide |
| SMILES | CC1CCCN(C(=O)c2ccn(-c3ccccc3)n2)C1CCCNC(=O)CCl |
| InChI | InChI=1S/C21H27ClN4O2/c1-16-7-6-13-25(19(16)10-5-12-23-20(27)15-22)21(28)18-11-14-26(24-18)17-8-3-2-4-9-17/h2-4,8-9,11,14,16,19H,5-7,10,12-13,15H2,1H3,(H,23,27) |
| InChIKey | VTTYJLPUJDHKBO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|