C15H10N6O3S — CID 167919937
N-[4-(4-nitrophenyl)-1H-pyrazol-5-yl]imidazo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 167919937) has the molecular formula C15H10N6O3S and a molecular weight of 354.35 g/mol. Its IUPAC name is N-[4-(4-nitrophenyl)-1H-pyrazol-5-yl]imidazo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N-[4-(4-nitrophenyl)-1H-pyrazol-5-yl]imidazo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 167919937 |
| Molecular Formula | C15H10N6O3S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | N-[4-(4-nitrophenyl)-1H-pyrazol-5-yl]imidazo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | O=C(Nc1[nH]ncc1-c1ccc([N+](=O)[O-])cc1)c1csc2nccn12 |
| InChI | InChI=1S/C15H10N6O3S/c22-14(12-8-25-15-16-5-6-20(12)15)18-13-11(7-17-19-13)9-1-3-10(4-2-9)21(23)24/h1-8H,(H2,17,18,19,22) |
| InChIKey | LMVUKKDYVMNSIG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|