C14H16ClNO5S — CID 167920847
3-[(5-chloro-3-methyl-1-benzofuran-2-yl)sulfonyl-methylamino]-2-methylpropanoic acid (PubChem CID 167920847) has the molecular formula C14H16ClNO5S and a molecular weight of 345.80 g/mol. Its IUPAC name is 3-[(5-chloro-3-methyl-1-benzofuran-2-yl)sulfonyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[(5-chloro-3-methyl-1-benzofuran-2-yl)sulfonyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 167920847 |
| Molecular Formula | C14H16ClNO5S |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 3-[(5-chloro-3-methyl-1-benzofuran-2-yl)sulfonyl-methylamino]-2-methylpropanoic acid |
| SMILES | Cc1c(S(=O)(=O)N(C)CC(C)C(=O)O)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C14H16ClNO5S/c1-8(13(17)18)7-16(3)22(19,20)14-9(2)11-6-10(15)4-5-12(11)21-14/h4-6,8H,7H2,1-3H3,(H,17,18) |
| InChIKey | ZJFNKSQPKLVGOB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.80 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |