C15H19FN4O — CID 167921529
4-(2,5-dimethylpiperazin-1-yl)-8-fluoro-7-methoxyquinazoline (PubChem CID 167921529) has the molecular formula C15H19FN4O and a molecular weight of 290.34 g/mol. Its IUPAC name is 4-(2,5-dimethylpiperazin-1-yl)-8-fluoro-7-methoxyquinazoline.
| Compound Name | 4-(2,5-dimethylpiperazin-1-yl)-8-fluoro-7-methoxyquinazoline |
|---|---|
| PubChem CID | 167921529 |
| Molecular Formula | C15H19FN4O |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4-(2,5-dimethylpiperazin-1-yl)-8-fluoro-7-methoxyquinazoline |
| SMILES | COc1ccc2c(N3CC(C)NCC3C)ncnc2c1F |
| InChI | InChI=1S/C15H19FN4O/c1-9-7-20(10(2)6-17-9)15-11-4-5-12(21-3)13(16)14(11)18-8-19-15/h4-5,8-10,17H,6-7H2,1-3H3 |
| InChIKey | CRHIACOYNOZZAP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |