C17H21FN4O2 — CID 124881405
(4aS,8aS)-4-(8-fluoro-7-methoxyquinazolin-4-yl)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine (PubChem CID 124881405) has the molecular formula C17H21FN4O2 and a molecular weight of 332.38 g/mol. Its IUPAC name is (4aS,8aS)-4-(8-fluoro-7-methoxyquinazolin-4-yl)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine.
| Compound Name | (4aS,8aS)-4-(8-fluoro-7-methoxyquinazolin-4-yl)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 124881405 |
| Molecular Formula | C17H21FN4O2 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (4aS,8aS)-4-(8-fluoro-7-methoxyquinazolin-4-yl)-6-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
| SMILES | COc1ccc2c(N3CCO[C@H]4CCN(C)C[C@@H]43)ncnc2c1F |
| InChI | InChI=1S/C17H21FN4O2/c1-21-6-5-13-12(9-21)22(7-8-24-13)17-11-3-4-14(23-2)15(18)16(11)19-10-20-17/h3-4,10,12-13H,5-9H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | UDONTKGJTLNVEF-STQMWFEESA-N |
| XLogP | 1.69 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |