C23H23N5O3 — CID 139800922
3-[1-(7,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]quinazolin-4-one (PubChem CID 139800922) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 3-[1-(7,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]quinazolin-4-one.
| Compound Name | 3-[1-(7,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 139800922 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-[1-(7,8-dimethoxyquinazolin-4-yl)piperidin-4-yl]quinazolin-4-one |
| SMILES | COc1ccc2c(N3CCC(n4cnc5ccccc5c4=O)CC3)ncnc2c1OC |
| InChI | InChI=1S/C23H23N5O3/c1-30-19-8-7-17-20(21(19)31-2)24-13-25-22(17)27-11-9-15(10-12-27)28-14-26-18-6-4-3-5-16(18)23(28)29/h3-8,13-15H,9-12H2,1-2H3 |
| InChIKey | GKXODKWXXFVUMB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |