C23H23N5O4 — CID 14668436
3-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-1H-quinazoline-2,4-dione (PubChem CID 14668436) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is 3-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 14668436 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 3-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]-1H-quinazoline-2,4-dione |
| SMILES | COc1cc2ncnc(N3CCC(n4c(=O)[nH]c5ccccc5c4=O)CC3)c2cc1OC |
| InChI | InChI=1S/C23H23N5O4/c1-31-19-11-16-18(12-20(19)32-2)24-13-25-21(16)27-9-7-14(8-10-27)28-22(29)15-5-3-4-6-17(15)26-23(28)30/h3-6,11-14H,7-10H2,1-2H3,(H,26,30) |
| InChIKey | OKBPWDPKWFFLCO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |