C18H23N5O2S — CID 14738824
1-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]imidazolidine-2-thione (PubChem CID 14738824) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]imidazolidine-2-thione.
| Compound Name | 1-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]imidazolidine-2-thione |
|---|---|
| PubChem CID | 14738824 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]imidazolidine-2-thione |
| SMILES | COc1cc2ncnc(N3CCC(N4CCNC4=S)CC3)c2cc1OC |
| InChI | InChI=1S/C18H23N5O2S/c1-24-15-9-13-14(10-16(15)25-2)20-11-21-17(13)22-6-3-12(4-7-22)23-8-5-19-18(23)26/h9-12H,3-8H2,1-2H3,(H,19,26) |
| InChIKey | LECPITFZNBDWLQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|