C18H22N6O2S2 — CID 14903389
5-[[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]methylamino]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 14903389) has the molecular formula C18H22N6O2S2 and a molecular weight of 418.55 g/mol. Its IUPAC name is 5-[[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]methylamino]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]methylamino]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 14903389 |
| Molecular Formula | C18H22N6O2S2 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 5-[[1-(6,7-dimethoxyquinazolin-4-yl)piperidin-4-yl]methylamino]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | COc1cc2ncnc(N3CCC(CNc4n[nH]c(=S)s4)CC3)c2cc1OC |
| InChI | InChI=1S/C18H22N6O2S2/c1-25-14-7-12-13(8-15(14)26-2)20-10-21-16(12)24-5-3-11(4-6-24)9-19-17-22-23-18(27)28-17/h7-8,10-11H,3-6,9H2,1-2H3,(H,19,22)(H,23,27) |
| InChIKey | ZYBKAVCMPVBRMM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|