C22H25N3O3S — CID 53113768
3-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]quinazolin-4-one (PubChem CID 53113768) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 3-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]quinazolin-4-one.
| Compound Name | 3-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 53113768 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 3-[1-(2,4,6-trimethylphenyl)sulfonylpiperidin-4-yl]quinazolin-4-one |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCC(n3cnc4ccccc4c3=O)CC2)c(C)c1 |
| InChI | InChI=1S/C22H25N3O3S/c1-15-12-16(2)21(17(3)13-15)29(27,28)24-10-8-18(9-11-24)25-14-23-20-7-5-4-6-19(20)22(25)26/h4-7,12-14,18H,8-11H2,1-3H3 |
| InChIKey | XWMIUEMKGYESCM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |