C15H18ClN3O3S — CID 53113790
6-chloro-3-(1-ethylsulfonylpiperidin-4-yl)quinazolin-4-one (PubChem CID 53113790) has the molecular formula C15H18ClN3O3S and a molecular weight of 355.85 g/mol. Its IUPAC name is 6-chloro-3-(1-ethylsulfonylpiperidin-4-yl)quinazolin-4-one.
| Compound Name | 6-chloro-3-(1-ethylsulfonylpiperidin-4-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 53113790 |
| Molecular Formula | C15H18ClN3O3S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 6-chloro-3-(1-ethylsulfonylpiperidin-4-yl)quinazolin-4-one |
| SMILES | CCS(=O)(=O)N1CCC(n2cnc3ccc(Cl)cc3c2=O)CC1 |
| InChI | InChI=1S/C15H18ClN3O3S/c1-2-23(21,22)18-7-5-12(6-8-18)19-10-17-14-4-3-11(16)9-13(14)15(19)20/h3-4,9-10,12H,2,5-8H2,1H3 |
| InChIKey | ROMHCYYPMZGZAV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |