C21H22ClN3O3S — CID 53113802
6-chloro-3-[1-(3,5-dimethylphenyl)sulfonylpiperidin-4-yl]quinazolin-4-one (PubChem CID 53113802) has the molecular formula C21H22ClN3O3S and a molecular weight of 431.95 g/mol. Its IUPAC name is 6-chloro-3-[1-(3,5-dimethylphenyl)sulfonylpiperidin-4-yl]quinazolin-4-one.
| Compound Name | 6-chloro-3-[1-(3,5-dimethylphenyl)sulfonylpiperidin-4-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 53113802 |
| Molecular Formula | C21H22ClN3O3S |
| Molecular Weight | 431.95 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 6-chloro-3-[1-(3,5-dimethylphenyl)sulfonylpiperidin-4-yl]quinazolin-4-one |
| SMILES | Cc1cc(C)cc(S(=O)(=O)N2CCC(n3cnc4ccc(Cl)cc4c3=O)CC2)c1 |
| InChI | InChI=1S/C21H22ClN3O3S/c1-14-9-15(2)11-18(10-14)29(27,28)24-7-5-17(6-8-24)25-13-23-20-4-3-16(22)12-19(20)21(25)26/h3-4,9-13,17H,5-8H2,1-2H3 |
| InChIKey | LYQZWACUKXIBEC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.95 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |