C21H22ClN3O4S — CID 53113939
3-[1-(5-chloro-2-methoxyphenyl)sulfonylpiperidin-4-yl]-6-methylquinazolin-4-one (PubChem CID 53113939) has the molecular formula C21H22ClN3O4S and a molecular weight of 447.94 g/mol. Its IUPAC name is 3-[1-(5-chloro-2-methoxyphenyl)sulfonylpiperidin-4-yl]-6-methylquinazolin-4-one.
| Compound Name | 3-[1-(5-chloro-2-methoxyphenyl)sulfonylpiperidin-4-yl]-6-methylquinazolin-4-one |
|---|---|
| PubChem CID | 53113939 |
| Molecular Formula | C21H22ClN3O4S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 3-[1-(5-chloro-2-methoxyphenyl)sulfonylpiperidin-4-yl]-6-methylquinazolin-4-one |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N1CCC(n2cnc3ccc(C)cc3c2=O)CC1 |
| InChI | InChI=1S/C21H22ClN3O4S/c1-14-3-5-18-17(11-14)21(26)25(13-23-18)16-7-9-24(10-8-16)30(27,28)20-12-15(22)4-6-19(20)29-2/h3-6,11-13,16H,7-10H2,1-2H3 |
| InChIKey | KCFRTQLNFCAHPA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |