C25H25ClN6O5 — CID 139907088
6-chloro-3-[1-(1,3-diethyl-6-nitro-2-oxobenzimidazole-5-carbonyl)piperidin-4-yl]quinazolin-4-one (PubChem CID 139907088) has the molecular formula C25H25ClN6O5 and a molecular weight of 524.97 g/mol. Its IUPAC name is 6-chloro-3-[1-(1,3-diethyl-6-nitro-2-oxobenzimidazole-5-carbonyl)piperidin-4-yl]quinazolin-4-one.
| Compound Name | 6-chloro-3-[1-(1,3-diethyl-6-nitro-2-oxobenzimidazole-5-carbonyl)piperidin-4-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 139907088 |
| Molecular Formula | C25H25ClN6O5 |
| Molecular Weight | 524.97 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 6-chloro-3-[1-(1,3-diethyl-6-nitro-2-oxobenzimidazole-5-carbonyl)piperidin-4-yl]quinazolin-4-one |
| SMILES | CCn1c(=O)n(CC)c2cc([N+](=O)[O-])c(C(=O)N3CCC(n4cnc5ccc(Cl)cc5c4=O)CC3)cc21 |
| InChI | InChI=1S/C25H25ClN6O5/c1-3-29-21-12-18(20(32(36)37)13-22(21)30(4-2)25(29)35)23(33)28-9-7-16(8-10-28)31-14-27-19-6-5-15(26)11-17(19)24(31)34/h5-6,11-14,16H,3-4,7-10H2,1-2H3 |
| InChIKey | WQMKWYJXDKVPBK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 125.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.97 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|