C25H28N4O6 — CID 139907076
3-[1-(4,5-diethoxy-2-nitrobenzoyl)piperidin-4-yl]-6-methylquinazolin-4-one (PubChem CID 139907076) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is 3-[1-(4,5-diethoxy-2-nitrobenzoyl)piperidin-4-yl]-6-methylquinazolin-4-one.
| Compound Name | 3-[1-(4,5-diethoxy-2-nitrobenzoyl)piperidin-4-yl]-6-methylquinazolin-4-one |
|---|---|
| PubChem CID | 139907076 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 3-[1-(4,5-diethoxy-2-nitrobenzoyl)piperidin-4-yl]-6-methylquinazolin-4-one |
| SMILES | CCOc1cc(C(=O)N2CCC(n3cnc4ccc(C)cc4c3=O)CC2)c([N+](=O)[O-])cc1OCC |
| InChI | InChI=1S/C25H28N4O6/c1-4-34-22-13-19(21(29(32)33)14-23(22)35-5-2)24(30)27-10-8-17(9-11-27)28-15-26-20-7-6-16(3)12-18(20)25(28)31/h6-7,12-15,17H,4-5,8-11H2,1-3H3 |
| InChIKey | IPKMFWNHXHCIJF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 116.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|