C14H14ClFN4O2 — CID 167924121
1-[(5-chloropyrazin-2-yl)methyl]-3-[(4-fluoro-2-methoxyphenyl)methyl]urea (PubChem CID 167924121) has the molecular formula C14H14ClFN4O2 and a molecular weight of 324.74 g/mol. Its IUPAC name is 1-[(5-chloropyrazin-2-yl)methyl]-3-[(4-fluoro-2-methoxyphenyl)methyl]urea.
| Compound Name | 1-[(5-chloropyrazin-2-yl)methyl]-3-[(4-fluoro-2-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 167924121 |
| Molecular Formula | C14H14ClFN4O2 |
| Molecular Weight | 324.74 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 1-[(5-chloropyrazin-2-yl)methyl]-3-[(4-fluoro-2-methoxyphenyl)methyl]urea |
| SMILES | COc1cc(F)ccc1CNC(=O)NCc1cnc(Cl)cn1 |
| InChI | InChI=1S/C14H14ClFN4O2/c1-22-12-4-10(16)3-2-9(12)5-19-14(21)20-7-11-6-18-13(15)8-17-11/h2-4,6,8H,5,7H2,1H3,(H2,19,20,21) |
| InChIKey | LZYXYPAXBDEGCP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.74 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |