C16H14Cl2FN3O4 — CID 171769814
4,6-dichloro-N-[(2,4-dimethoxyphenyl)methylcarbamoyl]-5-fluoropyridine-3-carboxamide (PubChem CID 171769814) has the molecular formula C16H14Cl2FN3O4 and a molecular weight of 402.21 g/mol. Its IUPAC name is 4,6-dichloro-N-[(2,4-dimethoxyphenyl)methylcarbamoyl]-5-fluoropyridine-3-carboxamide.
| Compound Name | 4,6-dichloro-N-[(2,4-dimethoxyphenyl)methylcarbamoyl]-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 171769814 |
| Molecular Formula | C16H14Cl2FN3O4 |
| Molecular Weight | 402.21 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 4,6-dichloro-N-[(2,4-dimethoxyphenyl)methylcarbamoyl]-5-fluoropyridine-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)NC(=O)c2cnc(Cl)c(F)c2Cl)c(OC)c1 |
| InChI | InChI=1S/C16H14Cl2FN3O4/c1-25-9-4-3-8(11(5-9)26-2)6-21-16(24)22-15(23)10-7-20-14(18)13(19)12(10)17/h3-5,7H,6H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | WBIIRSWZQCEIFU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.21 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|