C16H18ClNO5 — CID 167926695
1-[2-(4-chloro-2-methylphenoxy)ethylcarbamoyl]-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid (PubChem CID 167926695) has the molecular formula C16H18ClNO5 and a molecular weight of 339.78 g/mol. Its IUPAC name is 1-[2-(4-chloro-2-methylphenoxy)ethylcarbamoyl]-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid.
| Compound Name | 1-[2-(4-chloro-2-methylphenoxy)ethylcarbamoyl]-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid |
|---|---|
| PubChem CID | 167926695 |
| Molecular Formula | C16H18ClNO5 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-[2-(4-chloro-2-methylphenoxy)ethylcarbamoyl]-2-oxabicyclo[2.1.1]hexane-4-carboxylic acid |
| SMILES | Cc1cc(Cl)ccc1OCCNC(=O)C12CC(C(=O)O)(CO1)C2 |
| InChI | InChI=1S/C16H18ClNO5/c1-10-6-11(17)2-3-12(10)22-5-4-18-13(19)16-7-15(8-16,9-23-16)14(20)21/h2-3,6H,4-5,7-9H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | UZUBYFWHGFYZKO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|