C15H19N3O3 — CID 167929652
methyl 3-[[2-(1H-imidazol-2-yl)piperidin-1-yl]methyl]furan-2-carboxylate (PubChem CID 167929652) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 3-[[2-(1H-imidazol-2-yl)piperidin-1-yl]methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[[2-(1H-imidazol-2-yl)piperidin-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 167929652 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | methyl 3-[[2-(1H-imidazol-2-yl)piperidin-1-yl]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1CN1CCCCC1c1ncc[nH]1 |
| InChI | InChI=1S/C15H19N3O3/c1-20-15(19)13-11(5-9-21-13)10-18-8-3-2-4-12(18)14-16-6-7-17-14/h5-7,9,12H,2-4,8,10H2,1H3,(H,16,17) |
| InChIKey | VSTATYXOYROZDS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |