C10H10BrClFN3O2 — CID 167931660
2-[(4-bromo-2-chloro-5-fluorophenyl)carbamoylamino]-N-methylacetamide (PubChem CID 167931660) has the molecular formula C10H10BrClFN3O2 and a molecular weight of 338.56 g/mol. Its IUPAC name is 2-[(4-bromo-2-chloro-5-fluorophenyl)carbamoylamino]-N-methylacetamide.
| Compound Name | 2-[(4-bromo-2-chloro-5-fluorophenyl)carbamoylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 167931660 |
| Molecular Formula | C10H10BrClFN3O2 |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | 2-[(4-bromo-2-chloro-5-fluorophenyl)carbamoylamino]-N-methylacetamide |
| SMILES | CNC(=O)CNC(=O)Nc1cc(F)c(Br)cc1Cl |
| InChI | InChI=1S/C10H10BrClFN3O2/c1-14-9(17)4-15-10(18)16-8-3-7(13)5(11)2-6(8)12/h2-3H,4H2,1H3,(H,14,17)(H2,15,16,18) |
| InChIKey | FLYJYFVOQBIRTL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|