C14H16FN3O3S — CID 167934091
3-[4-(3-fluoro-4-methylphenyl)sulfonylpiperazin-1-yl]-3-oxopropanenitrile (PubChem CID 167934091) has the molecular formula C14H16FN3O3S and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-[4-(3-fluoro-4-methylphenyl)sulfonylpiperazin-1-yl]-3-oxopropanenitrile.
| Compound Name | 3-[4-(3-fluoro-4-methylphenyl)sulfonylpiperazin-1-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 167934091 |
| Molecular Formula | C14H16FN3O3S |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 3-[4-(3-fluoro-4-methylphenyl)sulfonylpiperazin-1-yl]-3-oxopropanenitrile |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)CC#N)CC2)cc1F |
| InChI | InChI=1S/C14H16FN3O3S/c1-11-2-3-12(10-13(11)15)22(20,21)18-8-6-17(7-9-18)14(19)4-5-16/h2-3,10H,4,6-9H2,1H3 |
| InChIKey | DWEOBFKSBCMMCX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |