C26H22N2O4 — CID 167935390
3-methyl-N-[4-methyl-2-(methylcarbamoyl)phenyl]-4-oxo-2-phenylchromene-8-carboxamide (PubChem CID 167935390) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is 3-methyl-N-[4-methyl-2-(methylcarbamoyl)phenyl]-4-oxo-2-phenylchromene-8-carboxamide.
| Compound Name | 3-methyl-N-[4-methyl-2-(methylcarbamoyl)phenyl]-4-oxo-2-phenylchromene-8-carboxamide |
|---|---|
| PubChem CID | 167935390 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 3-methyl-N-[4-methyl-2-(methylcarbamoyl)phenyl]-4-oxo-2-phenylchromene-8-carboxamide |
| SMILES | CNC(=O)c1cc(C)ccc1NC(=O)c1cccc2c(=O)c(C)c(-c3ccccc3)oc12 |
| InChI | InChI=1S/C26H22N2O4/c1-15-12-13-21(20(14-15)25(30)27-3)28-26(31)19-11-7-10-18-22(29)16(2)23(32-24(18)19)17-8-5-4-6-9-17/h4-14H,1-3H3,(H,27,30)(H,28,31) |
| InChIKey | WZFXDITVNABBOT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |