C24H17F2NO4 — CID 26894946
N-[2-(difluoromethoxy)phenyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide (PubChem CID 26894946) has the molecular formula C24H17F2NO4 and a molecular weight of 421.40 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
|---|---|
| PubChem CID | 26894946 |
| Molecular Formula | C24H17F2NO4 |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-3-methyl-4-oxo-2-phenylchromene-8-carboxamide |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)Nc3ccccc3OC(F)F)cccc2c1=O |
| InChI | InChI=1S/C24H17F2NO4/c1-14-20(28)16-10-7-11-17(22(16)31-21(14)15-8-3-2-4-9-15)23(29)27-18-12-5-6-13-19(18)30-24(25)26/h2-13,24H,1H3,(H,27,29) |
| InChIKey | QVMADDLJRPDYQD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |