C19H12ClN3O — CID 167936549
(E)-1-(2-chloroimidazo[1,2-a]pyridin-3-yl)-3-isoquinolin-4-ylprop-2-en-1-one (PubChem CID 167936549) has the molecular formula C19H12ClN3O and a molecular weight of 333.78 g/mol. Its IUPAC name is (E)-1-(2-chloroimidazo[1,2-a]pyridin-3-yl)-3-isoquinolin-4-ylprop-2-en-1-one.
| Compound Name | (E)-1-(2-chloroimidazo[1,2-a]pyridin-3-yl)-3-isoquinolin-4-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 167936549 |
| Molecular Formula | C19H12ClN3O |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | (E)-1-(2-chloroimidazo[1,2-a]pyridin-3-yl)-3-isoquinolin-4-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cncc2ccccc12)c1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C19H12ClN3O/c20-19-18(23-10-4-3-7-17(23)22-19)16(24)9-8-14-12-21-11-13-5-1-2-6-15(13)14/h1-12H/b9-8+ |
| InChIKey | OETSRVGVLDVVEY-CMDGGOBGSA-N |
| XLogP | 4.43 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|