About 5-[2,2-bis(hydroxymethyl)azetidine-1-carbonyl]-N-methylpyridine-2-carboxamide
5-[2,2-bis(hydroxymethyl)azetidine-1-carbonyl]-N-methylpyridine-2-carboxamide (PubChem CID 167937775) has the molecular formula C13H17N3O4
and a molecular weight of 279.30 g/mol. Its IUPAC name is 5-[2,2-bis(hydroxymethyl)azetidine-1-carbonyl]-N-methylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | 5-[2,2-bis(hydroxymethyl)azetidine-1-carbonyl]-N-methylpyridine-2-carboxamide |
| PubChem CID | 167937775 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 5-[2,2-bis(hydroxymethyl)azetidine-1-carbonyl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(C(=O)N2CCC2(CO)CO)cn1 |
| InChI | InChI=1S/C13H17N3O4/c1-14-11(19)10-3-2-9(6-15-10)12(20)16-5-4-13(16,7-17)8-18/h2-3,6,17-18H,4-5,7-8H2,1H3,(H,14,19) |
| InChIKey | OHTRSMJPLFDTPP-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2,2-bis(hydroxymethyl)azetidine-1-carbonyl]-N-methylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2,2-bis(hydroxymethyl)azetidine-1-carbonyl]-N-methylpyridine-2-carboxamide?
The IUPAC name of 5-[2,2-bis(hydroxymethyl)azetidine-1-carbonyl]-N-methylpyridine-2-carboxamide (CID 167937775) is 5-[2,2-bis(hydroxymethyl)azetidine-1-carbonyl]-N-methylpyridine-2-carboxamide.
What is the SMILES notation for 5-[2,2-bis(hydroxymethyl)azetidine-1-carbonyl]-N-methylpyridine-2-carboxamide?
The canonical SMILES for 5-[2,2-bis(hydroxymethyl)azetidine-1-carbonyl]-N-methylpyridine-2-carboxamide is CNC(=O)c1ccc(C(=O)N2CCC2(CO)CO)cn1.
What is the InChIKey of 5-[2,2-bis(hydroxymethyl)azetidine-1-carbonyl]-N-methylpyridine-2-carboxamide?
The InChIKey is OHTRSMJPLFDTPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O4/c1-14-11(19)10-3-2-9(6-15-10)12(20)16-5-4-13(16,7-17)8-18/h2-3,6,17-18H,4-5,7-8H2,1H3,(H,14,19).
What are the key properties of 5-[2,2-bis(hydroxymethyl)azetidine-1-carbonyl]-N-methylpyridine-2-carboxamide?
5-[2,2-bis(hydroxymethyl)azetidine-1-carbonyl]-N-methylpyridine-2-carboxamide has a molecular weight of 279.30 g/mol, XLogP of -0.99, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2,2-bis(hydroxymethyl)azetidine-1-carbonyl]-N-methylpyridine-2-carboxamide is sourced from PubChem (CID 167937775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).