C17H17N3O2S2 — CID 167939226
2-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanylmethyl]-1,3-thiazole (PubChem CID 167939226) has the molecular formula C17H17N3O2S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is 2-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanylmethyl]-1,3-thiazole.
| Compound Name | 2-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanylmethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 167939226 |
| Molecular Formula | C17H17N3O2S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-[[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanylmethyl]-1,3-thiazole |
| SMILES | CCn1c(-c2ccc3c(c2)OCCO3)cnc1SCc1nccs1 |
| InChI | InChI=1S/C17H17N3O2S2/c1-2-20-13(10-19-17(20)24-11-16-18-5-8-23-16)12-3-4-14-15(9-12)22-7-6-21-14/h3-5,8-10H,2,6-7,11H2,1H3 |
| InChIKey | WQTBWNOZCSQTRG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|