C25H28N4O3S — CID 17392830
2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 17392830) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is 2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 17392830 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanyl-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | CCn1c(-c2ccc3c(c2)OCCO3)cnc1SCC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H28N4O3S/c1-2-29-21(19-8-9-22-23(16-19)32-15-14-31-22)17-26-25(29)33-18-24(30)28-12-10-27(11-13-28)20-6-4-3-5-7-20/h3-9,16-17H,2,10-15,18H2,1H3 |
| InChIKey | NPPJXBHURUFQPG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|