C15H25N5O2S2 — CID 167939376
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[(2-methylpropanoylamino)methyl]piperidine-1-carboxamide (PubChem CID 167939376) has the molecular formula C15H25N5O2S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[(2-methylpropanoylamino)methyl]piperidine-1-carboxamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[(2-methylpropanoylamino)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 167939376 |
| Molecular Formula | C15H25N5O2S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-[(2-methylpropanoylamino)methyl]piperidine-1-carboxamide |
| SMILES | CCSc1nnc(NC(=O)N2CCCC(CNC(=O)C(C)C)C2)s1 |
| InChI | InChI=1S/C15H25N5O2S2/c1-4-23-15-19-18-13(24-15)17-14(22)20-7-5-6-11(9-20)8-16-12(21)10(2)3/h10-11H,4-9H2,1-3H3,(H,16,21)(H,17,18,22) |
| InChIKey | WYRYUGPAIFFBHC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|