C12H19N3O2 — CID 167940434
N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 167940434) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 167940434 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN1CC=C(CNC(=O)C2CNC(=O)C2)CC1 |
| InChI | InChI=1S/C12H19N3O2/c1-15-4-2-9(3-5-15)7-14-12(17)10-6-11(16)13-8-10/h2,10H,3-8H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | BIOQRQOVSXOHTN-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|