C18H22FN3O2 — CID 136520684
1-(4-fluorophenyl)-N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 136520684) has the molecular formula C18H22FN3O2 and a molecular weight of 331.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 136520684 |
| Molecular Formula | C18H22FN3O2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[(1-methyl-3,6-dihydro-2H-pyridin-4-yl)methyl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | CN1CC=C(CNC(=O)C2CCN(c3ccc(F)cc3)C2=O)CC1 |
| InChI | InChI=1S/C18H22FN3O2/c1-21-9-6-13(7-10-21)12-20-17(23)16-8-11-22(18(16)24)15-4-2-14(19)3-5-15/h2-6,16H,7-12H2,1H3,(H,20,23) |
| InChIKey | PAGGAZJAJZHDGT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|