C39H42N6O4 — CID 167940756
(4Z)-2-tert-butyl-N-[6-(2H-tetrazol-5-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-[(3,4,5-trimethoxyphenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxamide (PubChem CID 167940756) has the molecular formula C39H42N6O4 and a molecular weight of 658.80 g/mol. Its IUPAC name is (4Z)-2-tert-butyl-N-[6-(2H-tetrazol-5-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-[(3,4,5-trimethoxyphenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxamide.
| Compound Name | (4Z)-2-tert-butyl-N-[6-(2H-tetrazol-5-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-[(3,4,5-trimethoxyphenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxamide |
|---|---|
| PubChem CID | 167940756 |
| Molecular Formula | C39H42N6O4 |
| Molecular Weight | 658.80 g/mol |
| Exact Mass | 658.33 |
| IUPAC Name | (4Z)-2-tert-butyl-N-[6-(2H-tetrazol-5-yl)-1,2,3,4-tetrahydronaphthalen-1-yl]-4-[(3,4,5-trimethoxyphenyl)methylidene]-2,3-dihydro-1H-acridine-9-carboxamide |
| SMILES | COc1cc(/C=C2/CC(C(C)(C)C)Cc3c2nc2ccccc2c3C(=O)NC2CCCc3cc(-c4nn[nH]n4)ccc32)cc(OC)c1OC |
| InChI | InChI=1S/C39H42N6O4/c1-39(2,3)26-20-25(16-22-17-32(47-4)36(49-6)33(18-22)48-5)35-29(21-26)34(28-11-7-8-12-31(28)40-35)38(46)41-30-13-9-10-23-19-24(14-15-27(23)30)37-42-44-45-43-37/h7-8,11-12,14-19,26,30H,9-10,13,20-21H2,1-6H3,(H,41,46)(H,42,43,44,45)/b25-16- |
| InChIKey | JQOQISAODSPOKE-XYGWBWBKSA-N |
| XLogP | 7.40 |
| TPSA | 124.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.80 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |