C14H20ClN3O3 — CID 167942523
N'-[(6-chloro-5-methyl-2-pyridinyl)methoxy]-2-(oxolan-2-ylmethoxy)ethanimidamide (PubChem CID 167942523) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is N'-[(6-chloro-5-methyl-2-pyridinyl)methoxy]-2-(oxolan-2-ylmethoxy)ethanimidamide.
| Compound Name | N'-[(6-chloro-5-methyl-2-pyridinyl)methoxy]-2-(oxolan-2-ylmethoxy)ethanimidamide |
|---|---|
| PubChem CID | 167942523 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N'-[(6-chloro-5-methyl-2-pyridinyl)methoxy]-2-(oxolan-2-ylmethoxy)ethanimidamide |
| SMILES | Cc1ccc(CO/N=C(\N)COCC2CCCO2)nc1Cl |
| InChI | InChI=1S/C14H20ClN3O3/c1-10-4-5-11(17-14(10)15)7-21-18-13(16)9-19-8-12-3-2-6-20-12/h4-5,12H,2-3,6-9H2,1H3,(H2,16,18) |
| InChIKey | DFGXATGNPWRUEX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|