C14H15N3O4S2 — CID 167945861
N-[(6-morpholin-4-yl-2-pyridinyl)sulfonyl]thiophene-3-carboxamide (PubChem CID 167945861) has the molecular formula C14H15N3O4S2 and a molecular weight of 353.43 g/mol. Its IUPAC name is N-[(6-morpholin-4-yl-2-pyridinyl)sulfonyl]thiophene-3-carboxamide.
| Compound Name | N-[(6-morpholin-4-yl-2-pyridinyl)sulfonyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 167945861 |
| Molecular Formula | C14H15N3O4S2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | N-[(6-morpholin-4-yl-2-pyridinyl)sulfonyl]thiophene-3-carboxamide |
| SMILES | O=C(NS(=O)(=O)c1cccc(N2CCOCC2)n1)c1ccsc1 |
| InChI | InChI=1S/C14H15N3O4S2/c18-14(11-4-9-22-10-11)16-23(19,20)13-3-1-2-12(15-13)17-5-7-21-8-6-17/h1-4,9-10H,5-8H2,(H,16,18) |
| InChIKey | KWXXCDDJYAJBQK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |