C18H20FN3O2 — CID 167946087
1-[(3-fluoro-4-pyridin-3-ylphenyl)methyl]-3-(oxolan-2-ylmethyl)urea (PubChem CID 167946087) has the molecular formula C18H20FN3O2 and a molecular weight of 329.38 g/mol. Its IUPAC name is 1-[(3-fluoro-4-pyridin-3-ylphenyl)methyl]-3-(oxolan-2-ylmethyl)urea.
| Compound Name | 1-[(3-fluoro-4-pyridin-3-ylphenyl)methyl]-3-(oxolan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 167946087 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-[(3-fluoro-4-pyridin-3-ylphenyl)methyl]-3-(oxolan-2-ylmethyl)urea |
| SMILES | O=C(NCc1ccc(-c2cccnc2)c(F)c1)NCC1CCCO1 |
| InChI | InChI=1S/C18H20FN3O2/c19-17-9-13(5-6-16(17)14-3-1-7-20-11-14)10-21-18(23)22-12-15-4-2-8-24-15/h1,3,5-7,9,11,15H,2,4,8,10,12H2,(H2,21,22,23) |
| InChIKey | QWZAYQOFWNALPS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |