C16H22FNO4S — CID 167947922
2-[4-[(2-cyclohexyl-2-fluoroethyl)sulfamoyl]phenyl]acetic acid (PubChem CID 167947922) has the molecular formula C16H22FNO4S and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-[4-[(2-cyclohexyl-2-fluoroethyl)sulfamoyl]phenyl]acetic acid.
| Compound Name | 2-[4-[(2-cyclohexyl-2-fluoroethyl)sulfamoyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 167947922 |
| Molecular Formula | C16H22FNO4S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 2-[4-[(2-cyclohexyl-2-fluoroethyl)sulfamoyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(S(=O)(=O)NCC(F)C2CCCCC2)cc1 |
| InChI | InChI=1S/C16H22FNO4S/c17-15(13-4-2-1-3-5-13)11-18-23(21,22)14-8-6-12(7-9-14)10-16(19)20/h6-9,13,15,18H,1-5,10-11H2,(H,19,20) |
| InChIKey | QTCUGNIYIYYJIW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |