C13H15FO2 — CID 115033268
2-[4-[cyclobutyl(fluoro)methyl]phenyl]acetic acid (PubChem CID 115033268) has the molecular formula C13H15FO2 and a molecular weight of 222.26 g/mol. Its IUPAC name is 2-[4-[cyclobutyl(fluoro)methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[cyclobutyl(fluoro)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 115033268 |
| Molecular Formula | C13H15FO2 |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2-[4-[cyclobutyl(fluoro)methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(C(F)C2CCC2)cc1 |
| InChI | InChI=1S/C13H15FO2/c14-13(10-2-1-3-10)11-6-4-9(5-7-11)8-12(15)16/h4-7,10,13H,1-3,8H2,(H,15,16) |
| InChIKey | LFCRMPQULVEFEW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |