About (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-(4-methylphenyl)acetic acid;hydrochloride
(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-(4-methylphenyl)acetic acid;hydrochloride (PubChem CID 21117704) has the molecular formula C17H26ClNO3
and a molecular weight of 327.85 g/mol. Its IUPAC name is (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-(4-methylphenyl)acetic acid;hydrochloride.
Molecular Properties
| Compound Name | (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-(4-methylphenyl)acetic acid;hydrochloride |
| PubChem CID | 21117704 |
| Molecular Formula | C17H26ClNO3 |
| Molecular Weight | 327.85 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-(4-methylphenyl)acetic acid;hydrochloride |
| SMILES | CN1[C@@H]2CC[C@H]1CC(O)C2.Cc1ccc(CC(=O)O)cc1.Cl |
| InChI | InChI=1S/C9H10O2.C8H15NO.ClH/c1-7-2-4-8(5-3-7)6-9(10)11;1-9-6-2-3-7(9)5-8(10)4-6;/h2-5H,6H2,1H3,(H,10,11);6-8,10H,2-5H2,1H3;1H/t;6-,7+,8?; |
| InChIKey | XJYUOLJGEMERFT-UMQXVKPTSA-N |
| XLogP | 2.65 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.85 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-(4-methylphenyl)acetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-(4-methylphenyl)acetic acid;hydrochloride?
The IUPAC name of (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-(4-methylphenyl)acetic acid;hydrochloride (CID 21117704) is (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-(4-methylphenyl)acetic acid;hydrochloride.
What is the SMILES notation for (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-(4-methylphenyl)acetic acid;hydrochloride?
The canonical SMILES for (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-(4-methylphenyl)acetic acid;hydrochloride is CN1[C@@H]2CC[C@H]1CC(O)C2.Cc1ccc(CC(=O)O)cc1.Cl.
What is the InChIKey of (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-(4-methylphenyl)acetic acid;hydrochloride?
The InChIKey is XJYUOLJGEMERFT-UMQXVKPTSA-N. The full InChI is InChI=1S/C9H10O2.C8H15NO.ClH/c1-7-2-4-8(5-3-7)6-9(10)11;1-9-6-2-3-7(9)5-8(10)4-6;/h2-5H,6H2,1H3,(H,10,11);6-8,10H,2-5H2,1H3;1H/t;6-,7+,8?;.
What are the key properties of (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-(4-methylphenyl)acetic acid;hydrochloride?
(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-(4-methylphenyl)acetic acid;hydrochloride has a molecular weight of 327.85 g/mol, XLogP of 2.65, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol;2-(4-methylphenyl)acetic acid;hydrochloride is sourced from PubChem (CID 21117704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).