C16H11F5N2O4S — CID 167948794
2,3,4,5,6-pentafluoro-N-(5-methoxy-7-methyl-2-oxo-1,3-dihydroindol-3-yl)benzenesulfonamide (PubChem CID 167948794) has the molecular formula C16H11F5N2O4S and a molecular weight of 422.33 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-(5-methoxy-7-methyl-2-oxo-1,3-dihydroindol-3-yl)benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-(5-methoxy-7-methyl-2-oxo-1,3-dihydroindol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 167948794 |
| Molecular Formula | C16H11F5N2O4S |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-(5-methoxy-7-methyl-2-oxo-1,3-dihydroindol-3-yl)benzenesulfonamide |
| SMILES | COc1cc(C)c2c(c1)C(NS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)C(=O)N2 |
| InChI | InChI=1S/C16H11F5N2O4S/c1-5-3-6(27-2)4-7-13(5)22-16(24)14(7)23-28(25,26)15-11(20)9(18)8(17)10(19)12(15)21/h3-4,14,23H,1-2H3,(H,22,24) |
| InChIKey | JXNKEIVFRFFHQZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|