C11H13NO2S — CID 134935807
5-methoxy-7-methyl-3-methylsulfanyl-1,3-dihydroindol-2-one (PubChem CID 134935807) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is 5-methoxy-7-methyl-3-methylsulfanyl-1,3-dihydroindol-2-one.
| Compound Name | 5-methoxy-7-methyl-3-methylsulfanyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 134935807 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 5-methoxy-7-methyl-3-methylsulfanyl-1,3-dihydroindol-2-one |
| SMILES | COc1cc(C)c2c(c1)C(SC)C(=O)N2 |
| InChI | InChI=1S/C11H13NO2S/c1-6-4-7(14-2)5-8-9(6)12-11(13)10(8)15-3/h4-5,10H,1-3H3,(H,12,13) |
| InChIKey | WSUVPTVPMNXCLP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |