C17H23F2NO — CID 167949365
N-tert-butyl-N-ethyl-3-fluoro-3-(3-fluorophenyl)cyclobutane-1-carboxamide (PubChem CID 167949365) has the molecular formula C17H23F2NO and a molecular weight of 295.37 g/mol. Its IUPAC name is N-tert-butyl-N-ethyl-3-fluoro-3-(3-fluorophenyl)cyclobutane-1-carboxamide.
| Compound Name | N-tert-butyl-N-ethyl-3-fluoro-3-(3-fluorophenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 167949365 |
| Molecular Formula | C17H23F2NO |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-tert-butyl-N-ethyl-3-fluoro-3-(3-fluorophenyl)cyclobutane-1-carboxamide |
| SMILES | CCN(C(=O)C1CC(F)(c2cccc(F)c2)C1)C(C)(C)C |
| InChI | InChI=1S/C17H23F2NO/c1-5-20(16(2,3)4)15(21)12-10-17(19,11-12)13-7-6-8-14(18)9-13/h6-9,12H,5,10-11H2,1-4H3 |
| InChIKey | BIXYKBNBGDTDIO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |