C13H13ClF2N2O2 — CID 142422245
[(E)-[amino-[3-fluoro-3-(3-fluorophenyl)cyclobutyl]methylidene]amino] 2-chloroacetate (PubChem CID 142422245) has the molecular formula C13H13ClF2N2O2 and a molecular weight of 302.71 g/mol. Its IUPAC name is [(E)-[amino-[3-fluoro-3-(3-fluorophenyl)cyclobutyl]methylidene]amino] 2-chloroacetate.
| Compound Name | [(E)-[amino-[3-fluoro-3-(3-fluorophenyl)cyclobutyl]methylidene]amino] 2-chloroacetate |
|---|---|
| PubChem CID | 142422245 |
| Molecular Formula | C13H13ClF2N2O2 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | [(E)-[amino-[3-fluoro-3-(3-fluorophenyl)cyclobutyl]methylidene]amino] 2-chloroacetate |
| SMILES | N/C(=N/OC(=O)CCl)C1CC(F)(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C13H13ClF2N2O2/c14-7-11(19)20-18-12(17)8-5-13(16,6-8)9-2-1-3-10(15)4-9/h1-4,8H,5-7H2,(H2,17,18) |
| InChIKey | XRXJBOGGGXOPSS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|