C26H24Cl2F4N4O3 — CID 172934922
[(E)-[amino-[3-fluoro-3-(3-fluorophenyl)cyclobutyl]methylidene]amino] 2-chloroacetate;5-(chloromethyl)-3-[3-fluoro-3-(3-fluorophenyl)cyclobutyl]-1,2,4-oxadiazole (PubChem CID 172934922) has the molecular formula C26H24Cl2F4N4O3 and a molecular weight of 587.40 g/mol. Its IUPAC name is [(E)-[amino-[3-fluoro-3-(3-fluorophenyl)cyclobutyl]methylidene]amino] 2-chloroacetate;5-(chloromethyl)-3-[3-fluoro-3-(3-fluorophenyl)cyclobutyl]-1,2,4-oxadiazole.
| Compound Name | [(E)-[amino-[3-fluoro-3-(3-fluorophenyl)cyclobutyl]methylidene]amino] 2-chloroacetate;5-(chloromethyl)-3-[3-fluoro-3-(3-fluorophenyl)cyclobutyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 172934922 |
| Molecular Formula | C26H24Cl2F4N4O3 |
| Molecular Weight | 587.40 g/mol |
| Exact Mass | 586.12 |
| IUPAC Name | [(E)-[amino-[3-fluoro-3-(3-fluorophenyl)cyclobutyl]methylidene]amino] 2-chloroacetate;5-(chloromethyl)-3-[3-fluoro-3-(3-fluorophenyl)cyclobutyl]-1,2,4-oxadiazole |
| SMILES | Fc1cccc(C2(F)CC(c3noc(CCl)n3)C2)c1.N/C(=N/OC(=O)CCl)C1CC(F)(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C13H13ClF2N2O2.C13H11ClF2N2O/c14-7-11(19)20-18-12(17)8-5-13(16,6-8)9-2-1-3-10(15)4-9;14-7-11-17-12(18-19-11)8-5-13(16,6-8)9-2-1-3-10(15)4-9/h1-4,8H,5-7H2,(H2,17,18);1-4,8H,5-7H2 |
| InChIKey | GNWXYXYVTAHQKH-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.40 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|