C15H22FNO3S — CID 71916976
N-tert-butyl-2-ethylsulfonyl-N-[(3-fluorophenyl)methyl]acetamide (PubChem CID 71916976) has the molecular formula C15H22FNO3S and a molecular weight of 315.41 g/mol. Its IUPAC name is N-tert-butyl-2-ethylsulfonyl-N-[(3-fluorophenyl)methyl]acetamide.
| Compound Name | N-tert-butyl-2-ethylsulfonyl-N-[(3-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 71916976 |
| Molecular Formula | C15H22FNO3S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-tert-butyl-2-ethylsulfonyl-N-[(3-fluorophenyl)methyl]acetamide |
| SMILES | CCS(=O)(=O)CC(=O)N(Cc1cccc(F)c1)C(C)(C)C |
| InChI | InChI=1S/C15H22FNO3S/c1-5-21(19,20)11-14(18)17(15(2,3)4)10-12-7-6-8-13(16)9-12/h6-9H,5,10-11H2,1-4H3 |
| InChIKey | DXTUDYIHHLBJDH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |